BindingDB logo
myBDB logout

9 SMILES Strings for Mannosidase 2, alpha B1

Compound NameSMILES String
BDBM18351 OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O
BDBM18353 CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM18355 CCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM50031480 CN1C[C@@H](O)[C@H](O)[C@H]1CO
BDBM50031481 OC[C@H]1N[C@H](CO)[C@@H](O)[C@@H]1O |r|
BDBM50031482 CCCCN1[C@H](CO)[C@@H](O)[C@H](O)[C@H]1CO
BDBM50031483 CN1[C@H](CO)[C@@H](O)[C@H](O)[C@H]1CO
BDBM50031484 CCCCN1C[C@@H](O)[C@H](O)[C@H]1CO
BDBM50016703 OC[C@H]1NC[C@@H](O)[C@@H]1O |r|