BindingDB logo
myBDB logout

7 SMILES Strings for Mannosyl-oligosaccharide alpha-1,2-mannosidase isoform B

Compound NameSMILES String
BDBM50078117 CS[C@@H]1[C@@H](N)[C@@H](O)[C@@H](O)[C@H]1O
BDBM50168995 O[C@@H]1CN2CCC[C@@H](O)[C@@H]2[C@@H]1O |r|
BDBM50339272 OC[C@H]1O[C@@H]([C@@H](O)[C@@H](O)[C@@H]1O)S(=O)CCc1ccccc1 |r|
BDBM50339273 OC[C@H]1O[C@@H]([C@@H](O)[C@@H](O)[C@@H]1O)S(=O)(=O)Cc1ccccc1 |r|
BDBM50339274 OC[C@H]1O[C@@H]([C@@H](O)[C@@H](O)[C@@H]1O)S(=O)(=O)CCc1ccccc1 |r|
BDBM50339276 CCCCCCCCS(=O)(=O)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |r|
BDBM50339275 CCCCCCS(=O)(=O)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |r|