BindingDB logo
myBDB logout

4 SMILES Strings for Mast cell carboxypeptidase A

Compound NameSMILES String
BDBM50058391 COc1ccc(cc1)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)C(F)(F)F
BDBM50121917 OC(=O)CCC(Cc1ccccc1)C(O)=O
BDBM50121929 OC(=O)CC(Cc1ccccc1)C(O)=O
BDBM50281176 OC(=O)[C@@H](CS)Cc1ccccc1