BindingDB logo
myBDB logout

27 SMILES Strings for Matrix metalloproteinase (1 and 13)

Compound NameSMILES String
BDBM50450368 CC(C)CC(CC(=O)NO)C(=O)N[C@H]1CCCCNCCCCCNC1=O |r|
BDBM50013124 CCOP([O-])(=O)N[C@@H]([C@@H](C)CC)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC
BDBM50367930 [K+].[K+].CCOP([O-])(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)NCC([O-])=O |r|
BDBM50076989 CNC(=O)[C@@H]1CCCCN(CCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO)S(=O)(=O)c1cn(C)cn1
BDBM50076991 CNC(=O)[C@@H]1CCCCN(CCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO)S(=O)(=O)c1ccccc1
BDBM50076992 CNC(=O)[C@@H]1CCCCN(CCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO)S(=O)(=O)c1ccc(N)cc1
BDBM50076993 CNC(=O)[C@@H]1CCCCNCCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO
BDBM50076995 CNC(=O)[C@@H]1CCCCN(CCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO)C(=O)OC(C)(C)C
BDBM50082214 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cc2ccccc2o1)[C@H](O)C(=O)NO
BDBM50096463 COc1ccc(cc1)S(=O)(=O)N(Cc1cccnc1)c1c(C)cccc1C(=O)NO
BDBM50101522 Cc1ccc(CCC[C@H](CP(O)(O)=O)C(=O)N[C@@H](CC2CCCCC2)C(=O)NCCc2ccccc2)cc1
BDBM50105439 COc1ccc(cc1)S(=O)(=O)CC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)NO
BDBM50105450 ONC(=O)C1(CS(=O)(=O)c2ccc(Oc3ccccc3)cc2)CCCN1CC#C
BDBM50171860 CCOP(=O)(N1Cc2ccccc2C[C@@H]1C(=O)NO)c1ccc(OC)cc1
BDBM50283779 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)N[C@@H](CCN1C(=O)c2ccccc2C1=O)P(O)(O)=O
BDBM50291702 COc1ccc(cc1)[P@](=O)(OCC(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291703 COc1ccc(cc1)[P@@](=O)(OCCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291704 COc1ccc(cc1)[P@](=O)(OCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291705 COc1ccc(cc1)[P@@](=O)(OCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291706 CCOCCOc1ccc(cc1)[P@@](=O)(OCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291707 COc1ccc(cc1)[P@@](=O)(OCCF)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291708 CCOCCOc1ccc(cc1)[P@@](=O)(OCC)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50287489 CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)C1(CC(=O)NO)Cc2ccccc12
BDBM50287502 CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)C1(CC(CCN2C(=O)c3cc4ccccc4cc3C2=O)C(O)=O)CCCCC1
BDBM50287503 CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)C1(CC(CCN2C(=O)c3cc4ccccc4cc3C2=O)C(O)=O)CCCC1
BDBM50287505 CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)C1(CCCCC1)NC(CCN1C(=O)c2cc3ccccc3cc2C1=O)C(O)=O
BDBM50367932 CCOP([O-])(=O)N[C@@H]([C@@H](C)CC)C(=O)NC(Cc1ccc(OCc2cc(Cl)cc(Cl)c2)cc1)C(=O)NCC([O-])=O |r|