BindingDB logo
myBDB logout

18 SMILES Strings for Matrix metalloproteinase (2 and 3)

Compound NameSMILES String
BDBM50031771 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCC(=O)NCCc1ccccc1)CC(=O)NO
BDBM50031778 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCOCc1ccccc1)CC(=O)NO
BDBM50031783 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCOCc1ccccc1)CC(=O)NO
BDBM50031784 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCOc1ccccc1)CC(=O)NO
BDBM50031790 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCCOc1ccccc1)CC(=O)NO
BDBM50031791 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCC(=O)NCc1ccccc1)CC(=O)NO
BDBM50101522 Cc1ccc(CCC[C@H](CP(O)(O)=O)C(=O)N[C@@H](CC2CCCCC2)C(=O)NCCc2ccccc2)cc1
BDBM50135601 CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)C(\CC(=O)NO)=C\C(C)C
BDBM50171860 CCOP(=O)(N1Cc2ccccc2C[C@@H]1C(=O)NO)c1ccc(OC)cc1
BDBM50291702 COc1ccc(cc1)[P@](=O)(OCC(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291703 COc1ccc(cc1)[P@@](=O)(OCCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291704 COc1ccc(cc1)[P@](=O)(OCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291705 COc1ccc(cc1)[P@@](=O)(OCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291706 CCOCCOc1ccc(cc1)[P@@](=O)(OCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291707 COc1ccc(cc1)[P@@](=O)(OCCF)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291708 CCOCCOc1ccc(cc1)[P@@](=O)(OCC)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50290671 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CSC)NC(=O)[C@@H](S)CCN1C(=O)CCC1=O
BDBM50213210 [H][C@]12C[C@@]3(C=C(OC)C(=O)C=C3O1)[C@H](C)[C@H](C2)c1ccc2OCOc2c1 |c:10,t:4|