BindingDB logo
myBDB logout

18 SMILES Strings for Matrix metalloproteinase 12

Compound NameSMILES String
BDBM8465 COc1ccc(cc1)S(=O)(=O)N(Cc1cccnc1)[C@H](C(C)C)C(=O)NO |r|
BDBM11337 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)C(C)C(=O)NO
BDBM11343 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@@H](C(C)C)C(=O)NO |r|
BDBM13118 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@@H](C)C(=O)NO |r|
BDBM13119 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@H](C)C(=O)NO |r|
BDBM13122 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@H](CC(C)C)C(=O)NO |r|
BDBM13123 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@@H](C(=O)NO)c1ccccc1 |r|
BDBM13126 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@H](C(C)C)C(=O)NO |r|
BDBM50068847 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccn1)[C@@H](C(C)C)C(=O)NO
BDBM50068848 CC[C@@H](C)C[C@@H](N(Cc1ccccc1)S(=O)(=O)c1ccc(OC)cc1)C(=O)NO
BDBM50068849 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccn1)[C@H](CC(C)C)C(=O)NO
BDBM50068850 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@H](C1CCCC1)C(=O)NO
BDBM50068851 CC[C@H](C)C[C@@H](N(Cc1ccccc1)S(=O)(=O)c1ccc(OC)cc1)C(=O)NO
BDBM50068852 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@H](CCCCNC(=O)Oc1ccccc1)C(=O)NO
BDBM50068853 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccn1)[C@H](C(C)C)C(=O)NO
BDBM50068854 COc1ccc(cc1)S(=O)(=O)N(Cc1ccccc1)[C@H](C1CCNCC1)C(=O)NO
BDBM50295479 CC(C)[C@H](NS(=O)(=O)c1ccc2c(c1)oc1ccc(cc21)N1CCOC1=O)C(O)=O |r|
BDBM50360969 CC(C)[C@H](NS(=O)(=O)c1ccc2c(c1)oc1ccc(cc21)-c1nccs1)C(O)=O |r|