BindingDB logo
myBDB logout

25 SMILES Strings for Matrix metalloproteinase 2/9

Compound NameSMILES String
BDBM50069214 CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCc1ccccc1)[C@@](C)(O)C(=O)NO
BDBM50069218 CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)[C@H](CC(C)C)[C@@](C)(O)C(=O)NO
BDBM50069221 CNC(=O)[C@@H](NC(=O)[C@H](CCCc1ccccc1)[C@@](C)(O)C(=O)NO)C(C)(C)C
BDBM50069228 CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)[C@H](CCCc1ccccc1)[C@@](C)(O)C(=O)NO
BDBM50076990 CNC(=O)[C@@H]1CCCCN(CCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO)S(=O)(=O)C(F)(F)F
BDBM50076991 CNC(=O)[C@@H]1CCCCN(CCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO)S(=O)(=O)c1ccccc1
BDBM50076994 CNC(=O)[C@@H]1CCCCN(CCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO)S(=O)(=O)c1c(C)cc(C)cc1C
BDBM50076995 CNC(=O)[C@@H]1CCCCN(CCC[C@@H]([C@@H](CC(C)C)C(=O)N1)C(=O)NO)C(=O)OC(C)(C)C
BDBM50081790 ONC(=O)CN(CCCCc1ccccc1)C(=O)CN(CCCc1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1
BDBM50081771 CCCC(C)N(CC(=O)NO)C(=O)CN(CCCc1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1
BDBM50081778 ONC(=O)CN(Cc1ccccc1)C(=O)CN(CCCc1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1
BDBM50096463 COc1ccc(cc1)S(=O)(=O)N(Cc1cccnc1)c1c(C)cccc1C(=O)NO
BDBM50101522 Cc1ccc(CCC[C@H](CP(O)(O)=O)C(=O)N[C@@H](CC2CCCCC2)C(=O)NCCc2ccccc2)cc1
BDBM50105450 ONC(=O)C1(CS(=O)(=O)c2ccc(Oc3ccccc3)cc2)CCCN1CC#C
BDBM50135601 CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)C(\CC(=O)NO)=C\C(C)C
BDBM50171860 CCOP(=O)(N1Cc2ccccc2C[C@@H]1C(=O)NO)c1ccc(OC)cc1
BDBM50291702 COc1ccc(cc1)[P@](=O)(OCC(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291703 COc1ccc(cc1)[P@@](=O)(OCCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291704 COc1ccc(cc1)[P@](=O)(OCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291705 COc1ccc(cc1)[P@@](=O)(OCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291706 CCOCCOc1ccc(cc1)[P@@](=O)(OCCC(F)(F)F)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291707 COc1ccc(cc1)[P@@](=O)(OCCF)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50291708 CCOCCOc1ccc(cc1)[P@@](=O)(OCC)N1Cc2ccccc2C[C@@H]1C(=O)NO
BDBM50290436 CCCCCCCCC[C@H](CC(=O)NO)C(=O)N[C@H](C(=O)NC)C(C)(C)C
BDBM50290671 CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CSC)NC(=O)[C@@H](S)CCN1C(=O)CCC1=O