BindingDB logo
myBDB logout

19 SMILES Strings for Matrix metalloproteinase 9

Compound NameSMILES String
BDBM8465 COc1ccc(cc1)S(=O)(=O)N(Cc1cccnc1)[C@H](C(C)C)C(=O)NO |r|
BDBM50073883 CCO[C@H]1CC[C@](CS)(CC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccccc1 |wU:6.11,14.14,3.2,wD:6.6,(-2.44,-13.76,;-2.44,-12.22,;-1.11,-11.46,;-1.11,-9.92,;-2.43,-9.15,;-2.43,-7.61,;-1.11,-6.84,;-2.44,-6.07,;-2.44,-4.53,;.24,-7.61,;.24,-9.15,;.24,-6.07,;.24,-4.53,;1.57,-6.84,;2.9,-6.07,;2.9,-4.53,;3.66,-3.19,;5.2,-3.18,;5.95,-1.83,;5.14,-.49,;3.6,-.52,;2.87,-1.87,;4.23,-6.84,;4.23,-8.38,;5.56,-6.07,;6.9,-6.84,;6.88,-8.38,;8.21,-9.15,;9.54,-8.38,;9.56,-6.84,;8.22,-6.06,)|
BDBM50078568 CC(C)CN([C@@H](CCSCc1ccccc1)C(=O)NO)S(=O)(=O)c1ccc(cc1)-c1ccccc1
BDBM50078571 COc1ccc(cc1)S(=O)(=O)N(CC(=O)NC(c1ccccc1)c1ccccc1)[C@H](CCSCc1ccccc1)C(=O)NO
BDBM50116271 NCc1nc2ccc(NC(=O)C=Cc3cccnc3)cc2[nH]1 |w:12.12|
BDBM50116272 NCc1nc2ccc(NCc3ccccc3OCc3ccccc3)cc2[nH]1
BDBM50116273 NCc1nc2ccc(NC(=O)c3ccccc3OCc3ccccc3)cc2[nH]1
BDBM50116274 NCc1nc2ccc(NCc3ccc(OCc4ccccc4)cc3)cc2[nH]1
BDBM50116275 NCc1nc2ccc(NC(=O)C=Cc3c(F)cccc3F)cc2[nH]1 |w:12.12|
BDBM50116276 CC(=O)NCc1nc2ccc(NCc3ccccc3OCc3ccccc3)cc2[nH]1
BDBM50116277 NCc1nc2ccc(N)cc2[nH]1
BDBM50116278 NCc1nc2ccc(NCc3ccccc3Sc3ccccc3)cc2[nH]1
BDBM50116279 OCc1nc2ccc(NCc3ccccc3OCc3ccccc3)cc2[nH]1
BDBM50116280 CC(=O)N(Cc1ccccc1OCc1ccccc1)c1ccc2nc(CN)[nH]c2c1
BDBM50116281 NCc1nc2ccc(NC(=O)c3ccc(cc3)C(=O)c3ccccc3)cc2[nH]1
BDBM50116282 NCc1nc2ccc(NCc3ccccc3)cc2[nH]1
BDBM50116283 Cc1nc2ccc(NCc3ccccc3OCc3ccccc3)cc2[nH]1
BDBM50116284 NCc1cc2cc(NCc3ccccc3OCc3ccccc3)ccc2[nH]1
BDBM50116285 NCc1nc2ccc(NCC3CCC=CC3)cc2[nH]1 |c:13|