BindingDB logo
myBDB logout

1 SMILES String for Matrix metalloproteinase-12

Compound NameSMILES String
BDBM50360969 CC(C)[C@H](NS(=O)(=O)c1ccc2c(c1)oc1ccc(cc21)-c1nccs1)C(O)=O |r|