BindingDB logo
myBDB logout

2 SMILES Strings for Matrix metalloproteinase-20

Compound NameSMILES String
BDBM50063917 CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO)C(C)(C)C |r|
BDBM50365344 C[C@@](CCc1ccc(cc1)-c1ccccc1)(C(=O)NO)S(C)(=O)=O |r|