BindingDB logo
myBDB logout

6 SMILES Strings for Mcl-1 (residues 172-327)

Compound NameSMILES String
BDBM50400178 Cc1ccc(Sc2ccc3C(=O)c4cc(O)c(O)cc4C(=O)c3c2)cc1
BDBM50400179 Oc1cc2C(=O)c3ccc(Sc4ccccc4)cc3C(=O)c2cc1O
BDBM50400180 CC(C)c1ccc(Sc2ccc3C(=O)c4cc(O)c(O)cc4C(=O)c3c2)cc1
BDBM50400181 Oc1cc2C(=O)c3ccc(Br)cc3C(=O)c2cc1O
BDBM50400182 Oc1cc2C(=O)c3ccccc3C(=O)c2cc1O
BDBM50400183 Oc1cc(O)c2C(=O)c3ccccc3C(=O)c2c1