BindingDB logo
myBDB logout

7 SMILES Strings for Mediator of DNA damage checkpoint protein 1

Compound NameSMILES String
BDBM50070114 O=C1N(C2CCC(=O)NC2=O)C(=O)c2ccccc12
BDBM65497 O=C1N(Cc2c1cccc2OCc1ccc(CN2CCOCC2)cc1)[C@H]1CCC(=O)NC1=O
BDBM76986 Cc1nc2cccc(N)c2c(=O)n1C1CCC(=O)NC1=O
BDBM77001 O=C1N(Cc2c1cccc2OCc1ccc(CN2CCOCC2)cc1)C1CCC(=O)NC1=O
BDBM77015 O=C1N(Cc2c1cccc2OCc1ccc(CN2CCOCC2)cc1)[C@@H]1CCC(=O)NC1=O |r|
BDBM65454 Nc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O
BDBM65456 Nc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12