BindingDB logo
myBDB logout

7 SMILES Strings for Megakaryocyte protein-tyrosine phosphatase (PTP-MEG2)

Compound NameSMILES String
BDBM124260 [OH2+][V]12([OH2+])(=O)OC(=O)c3ccccc3[N]1=Cc1cc(Br)ccc1O2 |c:15|
BDBM124261 [OH2+][V]12([OH2+])(=O)OC(=O)c3ccccc3[N]1=Cc1cc(ccc1O2)[N+]([O-])=O |c:15|
BDBM124262 Clc1ccc2O[V]3(=O)(Oc4ccc(Cl)cc4C=[N]3c3ccccc3)[N](=Cc2c1)c1ccccc1 |c:17,27|
BDBM124263 Brc1ccc2O[V]3(=O)(Oc4ccc(Br)cc4C=[N]3c3ccccc3)[N](=Cc2c1)c1ccccc1 |c:17,27|
BDBM124264 [O-][N+](=O)c1ccc2O[V]3(=O)(Oc4ccc(cc4C=[N]3c3ccccc3)[N+]([O-])=O)[N](=Cc2c1)c1ccccc1 |c:18,31|
BDBM50107739 OP(O)(=O)C(F)(F)c1ccc(COc2ccc(OCc3ccc(cc3)C(F)(F)P(O)(O)=O)cc2)cc1
BDBM231167 COc1cc(CC(=O)NCC(NC(=O)C(CCCNC(=O)c2cccc(I)c2)NC(=O)C(Cc2ccc(cc2)C(F)(F)P(O)(O)=O)NC(=O)c2ccc(C)c(Br)c2)C(N)=O)ccc1O