BindingDB logo
myBDB logout

2 SMILES Strings for Melanocortin receptor (M4 and M5)

Compound NameSMILES String
BDBM50111167 N[C@@H](CCCNC(N)=N)C(=O)N(Cc1ccc2ccccc2c1)Cc1cccc2ccccc12
BDBM50111181 COc1ccc(CN[C@H](CCCNC([NH3+])=N)C(O)=O)cc1OC