BindingDB logo
myBDB logout

1 SMILES String for Melanocortin receptor 5

Compound NameSMILES String
BDBM50119368 Clc1ccc(C[C@@H](NC(=O)[C@H]2Cc3ccccc3CN2)C(=O)N2CCC(Cn3cncn3)(CC2)C2CCCCC2)cc1