BindingDB logo
myBDB logout

54 SMILES Strings for Melatonin

Compound NameSMILES String
BDBM9019 COc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM10755 NCCc1c[nH]c2ccc(O)cc12
BDBM22913 NC(SCCCc1cnc[nH]1)=NCCc1ccc(I)cc1 |w:11.12|
BDBM22914 S=C(NC1CCCCC1)N1CCC(CC1)c1cnc[nH]1
BDBM29611 COc1ccc2[nH]c(I)c(CCNC(C)=O)c2c1
BDBM29612 CC(=O)NCCc1c[nH]c2ccc(O)cc12
BDBM82509 COc1cc2c(CCNC(C)=O)c[nH]c2cc1O
BDBM82556 COc1cc2[nH]cc(CCNC(C)=O)c2cc1OC
BDBM82087 COc1ccc2[nH]cc(CCN)c2c1
BDBM82271 CC(=O)n1cc(CCN)c2cc(O)ccc12
BDBM85060 CC(=O)NC1(Cl)CC(c2ccccc2)c2ccccc2C1
BDBM85061 CC(=O)NCCc1c(C)[nH]c2cc(Cl)ccc12
BDBM85062 CCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85053 COc1ccc2[nH]cc(CCN3CCCC3=O)c2c1
BDBM85054 COc1ccc2[nH]cc(C3CCCN(C3)C(C)=O)c2c1
BDBM85055 CC(=O)NCCc1c(C)[nH]c2c(Cl)c(Cl)ccc12
BDBM85056 COc1cccc2CCC(Cl)(Cc12)NC(C)=O
BDBM85057 CC(=O)NCCc1c(Cc2ccc(C)cc2)[nH]c2ccccc12
BDBM85058 CC(=O)NC1CC(c2ccccc2)c2ccccc2C1
BDBM85059 COc1ccc(Cc2[nH]c3ccccc3c2CCNC(C)=O)cc1
BDBM85063 CC(=O)NCCc1c[nH]c2cc(Cl)ccc12
BDBM85064 CC(=O)NCCN1CCc2ccc3OCCc3c12
BDBM85065 CC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85066 COc1ccc2[nH]c(Cc3ccccc3)c(CCNC(C)=O)c2c1
BDBM85382 CCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85383 CCCCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccc(OC)cc12
BDBM85384 CCCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85385 CCCCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85237 CCCCCC(=O)NCCc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM85239 CCC(=O)NCCc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM85240 CCCCC(=O)NCCc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM50037220 COc1ccc2cccc(CCN3CCCC3=O)c2c1
BDBM50035176 COc1cccc2CCC(Cc12)NC(C)=O
BDBM50035179 COc1ccc2cccc(CCNC(C)=O)c2c1
BDBM50043289 COc1cc2c(CCNC(C)=O)c[nH]c2cc1Cl
BDBM50047013 COc1ccc2[nH]cc(CCO)c2c1
BDBM50045843 CCC(=O)NC1CCc2cccc(OC)c2C1
BDBM50066958 COc1ccc2c(CCNC(C)=O)c[nH]c2c1
BDBM50072650 COc1ccc2CC(CNC(C)=O)c2c1
BDBM50072651 CCC(=O)NCC1CCCc2ccc(OC)cc12
BDBM50072652 CCC(=O)NCC1CCc2ccc(OC)cc12
BDBM50072653 CCCC(=O)NCC1CCc2ccc(OC)cc12
BDBM50072654 COc1ccc2CCCC(CNC(C)=O)c2c1
BDBM50072655 CCCC(=O)NCC1Cc2ccc(OC)cc12
BDBM50072656 CCCC(=O)NCC1CCCCc2ccc(OC)cc12
BDBM50072657 COc1ccc2CCCCC(CNC(C)=O)c2c1
BDBM50072658 CCC(=O)NCC1Cc2ccc(OC)cc12
BDBM50072659 COc1ccc2CCC(CNC(C)=O)c2c1
BDBM50072660 CCCC(=O)NCC1CCCc2ccc(OC)cc12
BDBM50072661 CCC(=O)NCC1CCCCc2ccc(OC)cc12
BDBM50094703 Nc1ncnc2nc(cc(-c3cccc(Br)c3)c12)-c1ccc(nc1)N1CCOCC1
BDBM50133817 CC(C)(C)c1ccc(NC(=O)N2CCN(CC2)c2ncccc2Cl)cc1
BDBM50240440 CCC(=O)NC1CC(c2ccccc2)c2ccccc2C1
BDBM50282758 CC(=O)NCCc1c[nH]c2ccccc12