BindingDB logo
myBDB logout

23 SMILES Strings for Melatonin 1C

Compound NameSMILES String
BDBM9019 COc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM85062 CCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85065 CC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85382 CCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85383 CCCCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccc(OC)cc12
BDBM85384 CCCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85385 CCCCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12
BDBM85237 CCCCCC(=O)NCCc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM85238 CCCC(=O)NCCc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM85239 CCC(=O)NCCc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM85240 CCCCC(=O)NCCc1ccc2[nH]cc(CCNC(C)=O)c2c1
BDBM50411361 CC(=O)NCC(C)(C)c1cn2CCCc3cccc1c23
BDBM50423055 CCC(=O)NCCc1cn2CCCc3cccc1c23
BDBM50423058 O=C(NCCc1cn2CCCc3cccc1c23)C1CC1
BDBM50423060 CC(=O)NCCCc1cn2CCCc3cccc1c23
BDBM50423063 CCCC(=O)NCCc1cn2CCCc3cccc1c23
BDBM50423064 CCC(=O)NCCCc1cn2CCCc3cccc1c23
BDBM50423065 CC(=O)NCCc1cn2CCCc3cccc1c23
BDBM50423059 CCCC(=O)NCCCc1cn2CCCc3cccc1c23
BDBM50423061 CCCC(=O)NCC1(CCCCC1)c1cn2CCCc3cccc1c23
BDBM50423062 O=C(NCCCc1cn2CCCc3cccc1c23)C1CCC1
BDBM50423056 CC(=O)NCC1(CCCCC1)c1cn2CCCc3cccc1c23
BDBM50423057 O=C(NCCCc1cn2CCCc3cccc1c23)C1CC1