BindingDB logo
myBDB logout

18 SMILES Strings for Membrane-bound aminopeptidase P (APP2)

Compound NameSMILES String
BDBM50078390 CC(C)C[C@H](N)[C@H](O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(N)=O
BDBM50078391 C[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSCN1C(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(N)=O
BDBM50078392 CC(C)C[C@@H](N)[C@@H](O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(N)=O
BDBM50078393 C[C@H](NC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(=O)N[C@@H](CS)C(N)=O
BDBM50078394 N[C@H](Cc1ccccc1)[C@H](O)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(N)=O
BDBM50078395 C[C@H](NC(=O)[C@@H]1CCCN1C(=O)C1CCCCC1C(=O)NO)C(N)=O
BDBM50078396 C[C@H](NC(=O)[C@@H]1CCCN1C(=O)C1CCCC1S)C(N)=O
BDBM50078397 CC(C)C[C@@H](N)C(O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(N)=O
BDBM50078398 C[C@H](NC(=O)[C@@H]1CCCN1C(CCc1ccccc1)C(O)=O)C(N)=O
BDBM50078399 CC(C)C[C@H](N)[C@H](O)CC(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(N)=O
BDBM50078400 C[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CC(O)CN1C(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(N)=O
BDBM50078401 C[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(N)=O
BDBM50078402 CC(C)CC(N)[C@@H](O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(N)=O
BDBM50351402 Cn1c2cc(N3CCC[C@@](C)(N)C3)n(Cc3cc(F)ccc3C#N)c2c(=O)n(C)c1=O |r|
BDBM197051 CC(C)C[C@H](S)C(=O)N1C[C@@H](F)C[C@H]1C(=O)N1CCC[C@H]1C(=O)N1CC[C@H](C1)C(O)=O |r|
BDBM197052 CC(C)C[C@H](S)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N1CC[C@@H](C1)C(O)=O |r|
BDBM197053 CC(C)C[C@H](S)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N1CCC[C@@H]1C(O)=O |r|
BDBM197054 CC(C)C[C@H](S)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N(C)[C@@H](C)C(O)=O |r|