BindingDB logo
myBDB logout

1 SMILES String for Metabotropic glutamate receptor 7

Compound NameSMILES String
BDBM50004881 NC(C(O)=O)c1ccc(cc1)P(O)(O)=O