BindingDB logo
myBDB logout

5 SMILES Strings for Metabotropic glutamate receptor 8

Compound NameSMILES String
BDBM17660 N[C@@H](Cn1oc(=O)[nH]c1=O)C(O)=O
BDBM17657 N[C@@H](CCC(O)=O)C(O)=O
BDBM66976 N[C@]1(CC[C@H](C1)C(O)=O)C(O)=O
BDBM50007548 N[C@@H](CCP(O)(O)=O)C(O)=O |r|
BDBM50034501 N[C@H](C(O)=O)c1cc(=O)[nH]o1