BindingDB logo
myBDB logout

19 SMILES Strings for Metacaspase

Compound NameSMILES String
BDBM14297 NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)c1nc2ccccc2s1 |r|
BDBM50313765 OCCCCN(CC#N)C(=O)OCc1ccccc1
BDBM50313782 O=C(OCc1ccccc1)N(CC#N)C1CCNCC1
BDBM50313766 O=C(OCc1ccccc1)N(CCCCN1CCCC1)CC#N
BDBM50313767 O=C(OCc1ccccc1)N(CCCCn1ccnc1)CC#N
BDBM50313768 O=C(OCc1ccccc1)N(CCCCN1CCCCC1)CC#N
BDBM50313769 Fc1ccc(cc1)N1CCN(CCCCN(CC#N)C(=O)OCc2ccccc2)CC1
BDBM50313770 Fc1ccc(cc1)C(N1CCN(CCCCN(CC#N)C(=O)OCc2ccccc2)CC1)c1ccc(F)cc1
BDBM50313771 [#7]\[#6](-[#7])=[#7]\[#6]-[#6]-[#6]-[#6@H](-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1)-[#6](=O)-c1nc2ccccc2s1 |r|
BDBM50313772 [#7]\[#6](-[#7])=[#7]\[#6]-[#6]-[#6]-[#6@H](-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1)-[#6](=O)-c1ccccn1 |r|
BDBM50313773 [#7]\[#6](-[#7])=[#7]\[#6]-[#6]-[#6]-[#6@H](-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1)-[#6](=O)-c1nccs1 |r|
BDBM50313774 [#6]-n1c(nc2ccccc12)-[#6](=O)-[#6@H](-[#6]-[#6]-[#6]\[#7]=[#6](\[#7])-[#7])-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1 |r|
BDBM50313775 [#7]\[#6](-[#7])=[#7]\[#6]-[#6]-[#6]-[#6@H](-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1)-[#6]=[#6]S(=O)(=O)c1ccccc1 |r,w:20.21|
BDBM50313776 [#7]\[#6](-[#7])=[#7]\[#6]-[#6]-[#6]-[#6]-[#6@H](-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1)-[#6](=O)-c1nc2ccccc2s1 |r|
BDBM50313777 [#6]-[#6](-[#6])-[#6]-[#6](-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1)-[#6](=O)-[#7]-[#6@@H](-[#6]-[#6]-[#6]\[#7]=[#6](\[#7])-[#7])-[#6](=O)-c1nc2ccccc2s1 |r|
BDBM50313778 [#6]-[#6](-[#6])-[#6](-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1)-[#6](=O)-[#7]-[#6@@H](-[#6]-[#6]-[#6]\[#7]=[#6](\[#7])-[#7])-[#6](=O)-c1nc2ccccc2s1 |r|
BDBM50313779 [#7]\[#6](-[#7])=[#7]\[#6]-[#6]-[#6]-[#6@H](-[#7]-[#6](=O)-[#8]-[#6]-c1ccccc1)C#N |r|
BDBM50313780 Nc1ccc(C[C@H](NC(=O)OCc2ccccc2)C#N)cc1 |r|
BDBM50313781 [#7]\[#6](-[#7])=[#7]\c1ccc(-[#6]-[#6@H](-[#7]-[#6](=O)-[#8]-[#6]-c2ccccc2)C#N)cc1 |r|