BindingDB logo
myBDB logout

13 SMILES Strings for Metallo-beta-lactamase

Compound NameSMILES String
BDBM36633 c1ccc(cc1)-c1ccccc1-c1nnn[nH]1
BDBM36634 Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1
BDBM36635 C(c1ccc(cc1)-c1ccccc1-c1nnn[nH]1)n1cnc2ccccc12
BDBM36636 Cc1nc2ccccc2n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1
BDBM36637 C(c1ccc(cc1)-c1ccccc1-c1nnn[nH]1)n1cnc2cccnc12
BDBM36638 CCCc1nc2ccc(Cl)nc2n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1
BDBM36639 CC(C)c1nc2c(C)ccnc2n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1
BDBM36640 CCCCc1nc2ccc(O)cc2c(=O)n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1
BDBM36641 C(Oc1ccc2c3CCC=Cc3[nH]c2c1)c1ccc(cc1)-c1ccccc1-c1nnn[nH]1 |c:9|
BDBM36642 Oc1ccc2c3CCC=Cc3n(Cc3ccc(cc3)-c3ccccc3-c3nnn[nH]3)c2c1 |c:8|
BDBM36643 C(c1ccc(cc1)-c1ccccc1-c1nnn[nH]1)n1c2C=CCCc2c2ccccc12 |c:23|
BDBM36644 CCCCc1nc2CCSc2c(=O)n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1
BDBM36645 CCCc1nc(CC)c(C=O)n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1