BindingDB logo
myBDB logout

21 SMILES Strings for Metallo-beta-lactamase VIM-2 (VIM-2)

Compound NameSMILES String
BDBM153698 OC(=O)[C@@H]1CS[C@H]2CS[C@H](CS)N12 |r|
BDBM153699 OC(=O)[C@H]1CS[C@@H]2CS[C@@H](CS)N12 |r|
BDBM153700 CC1(C)S[C@H]2CS[C@H](CS)N2[C@@H]1C(O)=O |r|
BDBM153701 CC1(C)S[C@@H]2CS[C@@H](CS)N2[C@H]1C(O)=O |r|
BDBM21642 C[C@H](CS)C(=O)N1CCC[C@H]1C(O)=O
BDBM73278 CCCc1ccc(cc1)C(=O)CCC(O)=O
BDBM114408 OC(=O)CSc1ccnc2cc(Cl)ccc12
BDBM50174202 OC(=O)c1ccccc1C(=O)c1ccccc1
BDBM50336508 CC\C(C([O-])=O)=C(/CC)C([O-])=O
BDBM50442179 Cc1ccc2nc(cc(N3CCNCC3)c2c1)C(F)(F)F
BDBM50129030 OC(=O)c1ccccc1C(=O)c1ccc(Cl)cc1
BDBM50129035 Cn1c(S)nnc1C(F)(F)F
BDBM50129062 [H][C@]1([C@@H](C)O)C(=O)N2C(C(O)=O)=C(S[C@@H]3CN[C@@H](C3)C(=O)N(C)C)[C@H](C)[C@]12[H] |r,t:11|
BDBM50129065 O=c1c(coc2ccccc12)C#N
BDBM50129066 Oc1nc(cc(c1C#N)C(F)(F)F)-c1cccs1
BDBM50129069 COC(=O)c1ccccc1C(=O)c1ccccc1
BDBM50129079 CC(=O)c1ccccc1C(O)=O
BDBM50129082 OC(=O)c1cncc(c1)C#Cc1ccccc1
BDBM50129031 OC(=O)c1ccccc1Cc1ccccc1
BDBM50129032 OC(=O)c1ccccc1C(=O)c1ccc(F)cc1
BDBM50129081 OC(=O)CCCc1c[nH]c2ccccc12