BindingDB logo
myBDB logout

4 SMILES Strings for Metallo-beta-lactamase VIM-24 (VIM-24)

Compound NameSMILES String
BDBM153698 OC(=O)[C@@H]1CS[C@H]2CS[C@H](CS)N12 |r|
BDBM153699 OC(=O)[C@H]1CS[C@@H]2CS[C@@H](CS)N12 |r|
BDBM153700 CC1(C)S[C@H]2CS[C@H](CS)N2[C@@H]1C(O)=O |r|
BDBM153701 CC1(C)S[C@@H]2CS[C@@H](CS)N2[C@H]1C(O)=O |r|