BindingDB logo
myBDB logout

3 SMILES Strings for Metalloproteinase with thrombospondin motifs 4 (ADAMTS-4)

Compound NameSMILES String
BDBM194638 C[C@H](Cc1ccc(cc1)C(F)(F)F)C(=O)NC[C@]1(NC(=O)NC1=O)C1CC1 |r|
BDBM194639 CC[C@H](Cc1ccc(cc1)C(F)(F)F)C(=O)NC[C@]1(NC(=O)NC1=O)C1CC1 |r|
BDBM194644 FC(F)(F)c1ccc(C[C@@H](C2CC2)C(=O)NC[C@]2(NC(=O)NC2=O)C2CC2)cc1 |r|