BindingDB logo
myBDB logout

7 SMILES Strings for Methyl-accepting chemotaxis protein (McpS)

Compound NameSMILES String
BDBM23230 OC(=O)CC(=O)C(O)=O
BDBM26109 CCCC(O)=O
BDBM26121 OC(=O)CCC(O)=O
BDBM26122 OC(=O)\C=C\C(O)=O
BDBM92494 OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
BDBM92495 OC(CC(O)=O)C(O)=O
BDBM92496 OC(C(CC(O)=O)C(O)=O)C(O)=O