BindingDB logo
myBDB logout

25 SMILES Strings for Methyl-lysine binding protein (53BP1)

Compound NameSMILES String
BDBM154547 CC(C)NCCCNC(=O)c1cccc(Br)c1
BDBM154548 CN(CCCNC(=O)c1cccc(Br)c1)C(C)(C)C
BDBM154549 CC(C)(C)OCCCNC(=O)c1cccc(Br)c1
BDBM154550 Brc1cccc(c1)C(=O)NCCCN1CCCC1
BDBM154551 CC(C)(C)NCCCNS(=O)(=O)c1cccc(Br)c1
BDBM154552 CC(C)(C)NCCCNCc1cccc(Br)c1
BDBM154554 CC(C)(C)N1CCN(CC1)C(=O)c1cccc(Br)c1
BDBM154555 CC(C)(C)NCCCCNC(=O)c1cccc(Br)c1
BDBM154553 CC(C)(C)N1CCC(C1)NC(=O)c1cccc(Br)c1
BDBM154556 CC(C)(C)NCCCCCNC(=O)c1cccc(Br)c1
BDBM154557 CC(C)(C)NCCNC(=O)c1cccc(Br)c1
BDBM154558 CC(C)(C)NCCCNC(=O)c1ccccc1
BDBM154559 CC(C)(C)NCCCNC(=O)c1ccc(Br)cc1
BDBM154560 CC(C)(C)NCCCNC(=O)c1ccccc1Br
BDBM154561 CC(C)(C)NCCCNC(=O)c1cccc(Cl)c1
BDBM154562 CC(C)(C)NCCCNC(=O)c1cccc(F)c1
BDBM154563 CC(C)(C)NCCCNC(=O)c1cccc(I)c1
BDBM154564 CC(C)c1cccc(c1)C(=O)NCCCNC(C)(C)C
BDBM154565 CC(C)(C)NCCCNC(=O)c1cccc(c1)C(F)(F)F
BDBM154566 CC(C)(C)NCCCNC(=O)c1ccc(cc1)C(F)(F)F
BDBM154567 CC(C)(C)NCCCNC(=O)c1cccc(c1)[N+]([O-])=O
BDBM154568 CC(C)(C)NCCCNC(=O)c1cc(Br)ccn1
BDBM154569 CC(C)(C)NCCCNC(=O)c1cc(ccn1)C(F)(F)F
BDBM154545 CC(C)(C)NCCCNC(=O)c1cccc(Br)c1
BDBM154546 CN(C)CCCNC(=O)c1cccc(Br)c1