BindingDB logo
myBDB logout

7 SMILES Strings for Methylated AKR1B10 K125R/V301L (AKME2MU)

Compound NameSMILES String
BDBM16238 OC(=O)COc1cc(Cl)ccc1C(=O)NCc1ccc(Br)cc1F
BDBM104020 OC(=O)COc1cc(Cl)ccc1C(=O)NCc1ccc(Br)cc1
BDBM104022 OC(=O)COc1cc(Cl)ccc1C(=O)NCc1c(F)c(F)c(Br)c(F)c1F
BDBM50012899 CC1=C(CC(O)=O)c2cc(F)ccc2\C1=C/c1ccc(cc1)S(C)=O |c:1|
BDBM200220 OC(=O)COc1cc(Cl)ccc1C(=O)NCc1c(Br)cc(Br)cc1Br
BDBM200221 OC(=O)COc1cc(Cl)ccc1C(=O)NCc1c(Br)c(Br)c(Br)c(Br)c1Br
BDBM200222 COc1c(Br)c(Br)c(Br)c(Br)c1Cn1c(=O)ccn(CC(O)=O)c1=O