BindingDB logo
myBDB logout

1 SMILES String for Methylenetetrahydrofolate dehydrogenase

Compound NameSMILES String
BDBM50028981 CN1C(CCNc2ccc(cc2)C(=O)N[C@@H](CCC(O)=O)C(O)=O)CNc2nc(N)[nH]c(=O)c12 |r|