BindingDB logo
myBDB logout

8 SMILES Strings for Methylthioadenosine Nucleosidase (MTAN)

Compound NameSMILES String
BDBM22113 CSC[C@H]1CN(Cc2c[nH]c3c(N)ncnc23)C[C@@H]1O |r|
BDBM36435 CCSC[C@H]1CN(Cc2c[nH]c3c(N)ncnc23)C[C@@H]1O
BDBM36494 CCSCC1NC(C(O)C1O)c1c[nH]c2c(N)ncnc12
BDBM36495 Nc1ncnc2c(c[nH]c12)C1NC(CSCc2ccccc2)C(O)C1O
BDBM36496 Nc1ncnc2c(c[nH]c12)C1NC(CSc2ccc(Cl)cc2)C(O)C1O
BDBM36497 Nc1ncnc2c(CN3CC(O)C(CSCc4ccccc4)C3)c[nH]c12
BDBM36498 Nc1ncnc2c(CN3CC(O)C(CSc4ccc(Cl)cc4)C3)c[nH]c12
BDBM50170093 CSCC1[NH2+]C(C(O)C1O)c1c[nH]c2c(N)ncnc12