BindingDB logo
myBDB logout

6 SMILES Strings for Mevalonate pyrophosphate decarboxylase

Compound NameSMILES String
BDBM50287711 CN(CC([O-])=O)C(=O)COP([O-])(=O)OP([O-])([O-])=O
BDBM50287712 [O-]C(=O)CSCCOP([O-])(=O)OP([O-])([O-])=O
BDBM50287713 CN(CCOP([O-])(=O)OP([O-])([O-])=O)CC([O-])=O
BDBM50287714 O[C@](CF)(CCOP([O-])(=O)OP([O-])([O-])=O)CC([O-])=O
BDBM50287715 [O-]C(=O)[C@H]1CCCN1C(=O)COP([O-])(=O)OP([O-])([O-])=O
BDBM50287710 [O-]C(=O)[C@@H]1CCCN1C(=O)COP([O-])(=O)OP([O-])([O-])=O