BindingDB logo
myBDB logout

1 SMILES String for Microsomal prostaglandin E synthase-1

Compound NameSMILES String
BDBM50227631 Clc1ccc2c3[nH]c(nc3c3ccccc3c2c1)-c1c(cccc1C#N)C#N