BindingDB logo
myBDB logout

39 SMILES Strings for Microsomal triglyceride transfer protein large subunit

Compound NameSMILES String
BDBM50126213 CCCCOP(=O)(CCCSc1nc(c([nH]1)-c1ccccc1)-c1ccccc1)OCCCC
BDBM50126214 CC(C)OP(=O)(CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc12)OC(C)C
BDBM50126215 CCCCOP(=O)(CCCSc1ccncc1)OCCCC
BDBM50126216 CCCNC(=O)C1(CCCCP(=O)(OCC)OCC)c2ccccc2-c2ccccc12
BDBM50126217 CCOP(=O)(CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc12)OCC
BDBM50126218 CCCCOP(=O)(CCCSc1nc2ccc(OCC)cc2o1)OCCCC
BDBM50126219 CCCCOP(=O)(CCCOc1cccc2ccccc12)OCCCC
BDBM50126220 CCCOP(=O)(CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc12)OCCC
BDBM50126221 CCCCOP(=O)(CCCSc1nc2ccc(OCC)cc2n1C)OCCCC
BDBM50126222 Cc1cccc(CCCOP(=O)(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc23)OCCCc2cccc(C)n2)n1
BDBM50126187 CCCCOP(=O)(CCCCC1(C(=O)NCc2ccccc2)c2ccccc2-c2ccccc12)OCCCC
BDBM50126188 CCCCOP(=O)(CCCCC1(C(=O)NCCC)c2ccccc2-c2ccccc12)OCCCC
BDBM50126189 CCCCOP(=O)(CCCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc12)OCCCC
BDBM50126190 CCCCOP(=O)(CCCSc1nc2ccc(OCC)cc2[nH]1)OCCCC
BDBM50126191 CCCCOP(=O)(CCCCSc1nc2ccc(OCC)cc2s1)OCCCC
BDBM50126192 FC(F)(F)CNC(=O)C1(CCCCP(=O)(OCCc2ccccn2)OCCc2ccccn2)c2ccccc2-c2ccccc12
BDBM50126193 Cc1cccc(COP(=O)(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc23)OCc2cccc(C)n2)n1
BDBM50126194 CCCCOP(=O)(CCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc12)OCCCC
BDBM50126195 CCCCOP(=O)(CCCOc1ccccc1)OCCCC
BDBM50126196 CCCCOP(=O)(CCCSc1nc(c(o1)-c1ccccc1)-c1ccccc1)OCCCC
BDBM50126197 CCCCOP(=O)(CCCCC1(C(=O)NCCN2CCOCC2)c2ccccc2-c2ccccc12)OCCCC
BDBM50126198 CC(C)COP(=O)(CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc12)OCC(C)C
BDBM50126199 CCCCOP(=O)(CCCCCSc1nc2ccc(OCC)cc2s1)OCCCC
BDBM50126200 FC(F)(F)CNC(=O)C1(CCCN2CCC(CC2)NC(=O)c2ccccc2)c2ccccc2-c2ccccc12
BDBM50126201 CCCCOP(=O)(CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc12)OCCCC
BDBM50126202 CCNC(=O)C1(CC=C)c2ccccc2-c2ccccc12
BDBM50126203 CCCCNC(=O)C1(CCCCP(=O)(OCCCC)OCCCC)c2ccccc2-c2ccccc12
BDBM50126204 O=C1N(Cc2ccccc12)C1CCN(CCC(c2ccccc2)c2ccccc2)CC1
BDBM50126205 CCCCOP(=O)(CCCSc1nc2ccc(OCC)cc2s1)OCCCC
BDBM50126206 CCCCOP(=O)(CCCCC1(C(=O)OC)c2ccccc2-c2ccccc12)OCCCC
BDBM50126207 CCCCOP(=O)(CCCCC1(C(=O)NCCc2ccc(OC)cc2)c2ccccc2-c2ccccc12)OCCCC
BDBM50126223 CC(C)(C)COP(=O)(CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc12)OCC(C)(C)C
BDBM50126224 CCCCOP(=O)(CCCCC1(C(=O)NCc2ccccn2)c2ccccc2-c2ccccc12)OCCCC
BDBM50126225 FC(F)(F)CNC(=O)C1(CCCCP(=O)(OCCCc2ccccn2)OCCCc2ccccn2)c2ccccc2-c2ccccc12
BDBM50126208 CCCCOP(=O)(CCCSc1cccs1)OCCCC
BDBM50126209 FC(F)(F)CNC(=O)C1(CCCCP(=O)(OCc2cccnc2)OCc2cccnc2)c2ccccc2-c2ccccc12
BDBM50126210 CCCCOP(=O)(CCCCC1(C(=O)NCc2ccc(N)cc2)c2ccccc2-c2ccccc12)OCCCC
BDBM50126211 FC(F)(F)CNC(=O)C1(CCCCP(=O)(OCc2ccncc2)OCc2ccncc2)c2ccccc2-c2ccccc12
BDBM50126212 FC(F)(F)CNC(=O)C1(CCCCP(=O)(OCc2ccccn2)OCc2ccccn2)c2ccccc2-c2ccccc12