BindingDB logo
myBDB logout

1 SMILES String for Misshapen-like kinase 1 (MINK)

Compound NameSMILES String
BDBM103302 O=C(CN1CC[C@@H](C1)C(=O)Nc1ccc2[nH]nc(-c3ccncc3)c2c1)N1CCN(CC1)c1ccc(cc1)-c1ncccn1 |r|