BindingDB logo
myBDB logout

5 SMILES Strings for Mitochondrial complex I (NADH dehydrogenase)

Compound NameSMILES String
BDBM50135527 COc1cc2OC[C@H]3Oc4c5C[C@@H](Oc5ccc4C(=O)[C@H]3c2cc1OC)C(C)=C |r|
BDBM50280474 COc1cc2OCC34CC3(C(=O)c3ccc5O[C@H](Cc5c3O4)C(C)=C)c2cc1OC
BDBM50280475 COc1cc2OC[C@H]3Oc4c5C[C@@H](Oc5ccc4C(=O)[C@@]3(C)c2cc1OC)C(C)=C
BDBM50280476 COc1cc2OC[C@H]3Oc4c5C[C@@H](Oc5ccc4C(=O)[C@@]3(C)c2cc1OC)C(C)C
BDBM50366294 COc1cc2OC[C@@H]3Oc4c5C[C@@H](Oc5ccc4C(=O)[C@@]3(C)c2cc1OC)C(C)=C