BindingDB logo
myBDB logout

1 SMILES String for Mitochondrial complex II; succinate dehydrogenase

Compound NameSMILES String
BDBM50411094 Cc1ccc(Oc2ccc(NC(=O)c3ccc4c[nH]nc4c3O)cc2)cc1