BindingDB logo
myBDB logout

42 SMILES Strings for Mitochondrial complex V; ATP synthase

Compound NameSMILES String
BDBM50010132 CC1(C)Oc2ccc(cc2[C@H]([C@@H]1O)N1CCCC1=O)C#N |r|
BDBM50142256 CC(C)(C)c1ccc(cc1)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50142258 Cc1nc[nH]c1CN1C(CCc2ccccc2)CN(Cc2ccccc12)S(=O)(=O)c1ccc(cc1)C(C)(C)C
BDBM50142274 Cc1nc[nH]c1CN1C(CCc2ccccc2)CN(Cc2ccccc12)S(=O)(=O)c1ccc(Cl)c(Cl)c1
BDBM50404284 Cc1ccc(NC(=S)OC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1
BDBM50404285 FC(F)(F)c1ccc(c(c1)C(Cn1ccnc1)NC(Nc1ccc(Cl)cc1Cl)=NC#N)C(F)(F)F |w:28.31|
BDBM50404286 Cc1ccc(NC(=S)OC(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(C)c1
BDBM50404287 OC(C(Nc1ccc(Cl)cc1)=NC(Cn1ccnc1)c1ccc(Cl)cc1Cl)c1ccc(cc1)C#N |w:11.12|
BDBM50404288 OC(C(Nc1ccc(Cl)cc1)=NC(Cn1ccnc1)c1ccc(Cl)cc1Cl)c1cccc(c1)C#N |w:11.12|
BDBM50404289 Clc1ccc(NC(=S)OC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1
BDBM50404290 Clc1ccc(C(Cn2ccnc2)NC(Nc2ccccc2Cl)=NC#N)c(Cl)c1 |w:22.24|
BDBM50404291 Cc1ccc(C(Cn2ccnc2)OC(=S)Nc2ccc(Cl)cc2)c(C)c1
BDBM50404292 Clc1ccc(NC(NC(Cn2ccnc2)c2ccc(Cl)cc2Cl)=NC#N)cc1 |w:23.25|
BDBM50404293 OC(C(Nc1ccc(Cl)cc1)=NC(Cn1ccnc1)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |w:11.12|
BDBM50404294 Clc1ccc(C(Cn2ccnc2)NC(Nc2cccc(Cl)c2Cl)=NC#N)c(Cl)c1 |w:23.25|
BDBM50404295 Clc1ccc(C(Cn2ccnc2)OC(=S)Nc2ccccc2)c(Cl)c1
BDBM50404296 Clc1cccc(NC(NC(Cn2ccnc2)c2ccc(Cl)cc2Cl)=NC#N)c1 |w:24.26|
BDBM50404297 Clc1ccc(NC(=S)OC(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1
BDBM50404298 Clc1ccc(NC(=O)OC(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1
BDBM50404299 Clc1ccc(NC(=S)NC(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1
BDBM50404300 CCC(=O)C(NC(Cn1ccnc1)c1ccc(Cl)cc1Cl)Nc1ccc(Cl)cc1
BDBM50404301 Clc1ccc(NC(NC(Cn2ccnc2)c2ccc(Cl)cc2Cl)=NC#N)c(Cl)c1 |w:23.25|
BDBM50404302 CC(=O)Nc1ccc(cc1)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50404303 O=S(=O)(Cc1ccccc1)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50404304 [O-][N+](=O)c1cccc(c1)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50404305 CC(C)(C)c1ccc(cc1)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2ncc[nH]2)c2ccccc2C1
BDBM50404306 CC(C)(C)c1ccc(CN2CC(CCc3ccccc3)N(Cc3cnc[nH]3)c3ccccc3C2)cc1
BDBM50404307 COc1ccc(cc1)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50404308 Cc1ncc(CN2C(CCc3ccccc3)CN(Cc3ccccc23)S(=O)(=O)c2ccc(F)cc2)[nH]1
BDBM50404309 O=S(=O)(N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1)c1cccc2nonc12
BDBM50404310 Cc1nc[nH]c1CN1C(CCc2ccccc2)CN(Cc2ccc(cc2)C(C)(C)C)Cc2ccccc12
BDBM50404311 O=S(=O)(N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1)c1cccc2cccnc12
BDBM50404312 Clc1cc(ccc1S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1)C#N
BDBM50404313 O=S(=O)(N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1)c1ccccc1
BDBM50404314 Clc1ccc(Cl)c(c1)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50404315 O=S(=O)(N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1)c1cccs1
BDBM50404316 O=S(=O)(N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1)c1ccc(cc1)C#N
BDBM50404317 Oc1ccc(cc1)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50404318 Cc1nc[nH]c1CN1C(CCc2ccccc2)CN(Cc2ccccc12)S(=O)(=O)c1ccc(F)cc1
BDBM50404319 FC(F)(F)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50404320 Fc1ccc(cc1)S(=O)(=O)N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1
BDBM50404321 O=S(=O)(N1CC(CCc2ccccc2)N(Cc2cnc[nH]2)c2ccccc2C1)c1cccc2ccccc12