BindingDB logo
myBDB logout

1 SMILES String for Mitogen-Activated Protein Kinase 9 (JNK2) Mutant (C162S)

Compound NameSMILES String
BDBM26057 [O-][N+](=O)c1cnc(Sc2n[nH]c(=O)n2-c2ccc3OCCOc3c2)s1