BindingDB logo
myBDB logout

20 SMILES Strings for Mitogen-activated protein kinase kinase kinase 5

Compound NameSMILES String
BDBM50135286 Cn1c2nc(Nc3ccc4[nH]ccc4c3)ncc2cc(c1=O)S(=O)(=O)c1ccc(F)cc1F
BDBM50166588 C[C@@H](N1c2cc(ccc2C(=O)NC1(C)C)-n1c2cccnc2[nH]c1=O)c1ccccc1 |r|
BDBM50212284 CC(CF)n1cnnc1-c1cccc(n1)N1Cc2ccccc2C1=O
BDBM50212285 CC(C)n1cnnc1-c1cccc(NC(=O)c2ccc(C)cc2F)n1
BDBM50212255 CC(C)n1cnnc1-c1cccc(NC(=O)c2ccccc2)n1
BDBM50212280 C[C@H](CO)n1cnnc1-c1cccc(n1)N1Cc2ccccc2C1=O |r|
BDBM50212254 COCCOc1ccc2CN(C(=O)c2c1)c1cccc(n1)-c1nncn1[C@H](C)CO |r|
BDBM50212256 COCCOc1ccc2CN(C(=O)c2c1)c1cccc(n1)-c1nncn1C(C)C
BDBM50212257 CC[C@H](C)n1cnnc1-c1cccc(n1)N1Cc2ccccc2C1=O |r|
BDBM50212258 CC(C)n1cnnc1-c1cccc(NC(=O)c2cc(c(C)cc2F)-n2cnc(c2)C2CC2)n1
BDBM50212259 CC(CCO)n1cnnc1-c1cccc(n1)N1Cc2ccccc2C1=O
BDBM50212260 CC(C)Oc1ccc2CN(C(=O)c2c1)c1cccc(n1)-c1nncn1[C@H](C)CO |r|
BDBM50212261 CC(C)n1cnnc1-c1cccc(n1)N1Cc2ccc(OC[C@@H]3CN(C)CCO3)cc2C1=O |r|
BDBM50212262 CC(C)Oc1ccc2CN(C(=O)c2c1)c1cccc(n1)-c1nncn1C(C)C
BDBM50212263 CC(CC#N)n1cnnc1-c1cccc(n1)N1Cc2ccccc2C1=O
BDBM50212265 CC[C@@H](C)n1cnnc1-c1cccc(n1)N1Cc2ccccc2C1=O |r|
BDBM50212270 CC(C)n1cnnc1-c1cccc(n1)N1Cc2ccccc2C1=O
BDBM50212282 Cc1cc(F)c(cc1-n1cnc(c1)C1CC1)C(=O)Nc1ccccn1
BDBM50212278 C[C@@H](CO)n1cnnc1-c1cccc(n1)N1Cc2ccccc2C1=O |r|
BDBM50212279 O=C1N(Cc2ccccc12)c1cccc(n1)-c1nncn1CC1CCO1