BindingDB logo
myBDB logout

5 SMILES Strings for Mitogen-activated protein kinase phosphatase 5 (MKP5)

Compound NameSMILES String
BDBM50441296 O[C@@H](c1cccc(c1)-c1ccc(cc1)C(=O)P(O)(O)O)c1ccc(Cl)c(Cl)c1 |r|
BDBM50441297 O[C@H](c1cccc(c1)-c1ccc(cc1)C(=O)P(O)(O)O)c1ccc(Cl)c(Cl)c1 |r|
BDBM50441298 Oc1c(cccc1-c1cccc(c1)C(F)(F)P(O)(O)=O)C1CCCCC1
BDBM50087856 CCCCC(Oc1cc(O)c(cc1C#Cc1ccccc1OC(F)(F)F)C(O)=O)C(=O)NC1CCCCC1
BDBM50054344 Cn1c(c(I)c2cc(C(O)=O)c(O)cc12)-c1cccc(NC(=O)C(=O)Nc2ccc(cc2)-c2ccsc2)c1