BindingDB logo
myBDB logout

3 SMILES Strings for Mitotic kinesin Eg5 (Eg5)

Compound NameSMILES String
BDBM189359 O=C1CC(c2ccccc2)c2c(N1)n1ncnc1[nH]c2=O
BDBM189360 FC(F)(F)c1ccc(Nc2ncnc3[nH]ncc23)cc1
BDBM189361 Cc1ccc(cc1)C1C(C#N)=C(N)Nc2ncnn12 |t:11|