BindingDB logo
myBDB logout

8 SMILES Strings for Mixed Lineage Kinase 2 (MLK2)

Compound NameSMILES String
BDBM6760 COC(=O)[C@@]1(O)C[C@H]2O[C@]1(C)n1c3ccccc3c3c4CNC(=O)c4c4c5ccccc5n2c4c13 |r|
BDBM14173 O=C1NCc2c-3c(Cc4ccccc-34)c3[nH]c4ccccc4c3c12
BDBM14174 O=C1NCc2c1c1c([nH]c3ccccc13)c1CCc3ccccc3-c21
BDBM14177 O=C1NCc2c1c-1c(Cc3ccccc-13)c1[nH]c3ccccc3c21
BDBM14179 O=C1NCc2c1c1c3ccccc3sc1c1[nH]c3ccccc3c21
BDBM14186 O=C1NC(=O)c2c1c-1c(CCc3ccccc-13)c1[nH]c3ccccc3c21
BDBM24947 COc1ccc-2c(CCc3c-2c2C(=O)NCc2c2c4ccccc4n(CCO)c32)c1
BDBM24949 CC(C)Oc1ccc-2c(CCc3c-2c2C(=O)NCc2c2c4ccccc4n(CCO)c32)c1