BindingDB logo
myBDB logout

2 SMILES Strings for Mono [ADP-ribose] polymerase PARP16

Compound NameSMILES String
BDBM27566 Fc1ccc(Cc2n[nH]c(=O)c3ccccc23)cc1C(=O)N1CCN(CC1)C(=O)C1CC1
BDBM50145156 Cn1ncnc1[C@H]1[C@@H](Nc2cc(F)cc3c2c1n[nH]c3=O)c1ccc(F)cc1 |r|