BindingDB logo
myBDB logout

3 SMILES Strings for Monoacylglycerol lipase ABHD12

Compound NameSMILES String
BDBM24567 CCCCCCCCCCC[C@@H](C[C@@H]1OC(=O)[C@H]1CCCCCC)OC(=O)[C@H](CC(C)C)NC=O |r|
BDBM50240877 O=[#6](-[#7]-[#6]-[#6]-[#6]-[#6]-[#6]-[#6]-[#7]-[#6](=O)-[#8]\[#7]=[#6]-1\[#6]-[#6]-[#6]-[#6]-[#6]-1)-[#8]\[#7]=[#6]-1\[#6]-[#6]-[#6]-[#6]-[#6]-1
BDBM50323040 CC(=NOC(=O)Nc1ccccc1)c1cccc(c1)-c1cccs1 |w:2.2|