BindingDB logo
myBDB logout

39 SMILES Strings for Monoacylglycerol lipase ABHD6

Compound NameSMILES String
BDBM24567 CCCCCCCCCCC[C@@H](C[C@@H]1OC(=O)[C@H]1CCCCCC)OC(=O)[C@H](CC(C)C)NC=O |r|
BDBM50048618 CC1(C)CCc2cc(ccc2O1)S(=O)(=O)N(CC(O)=O)Cc1ccc(Oc2ccc(cn2)C(F)(F)F)cc1
BDBM50048621 CC1(C)CCc2cc(ccc2O1)S(=O)(=O)N(CC(O)=O)Cc1cccc(Oc2ccccc2)c1
BDBM50048620 CC1(C)CCc2cc(ccc2O1)S(=O)(=O)N(CC(O)=O)Cc1ccc(Oc2ccccc2)cc1
BDBM50065640 Clc1ccc2c(-[#6]-[#6]-c3cccnc3\[#6]-2=[#6]-2\[#6]-[#6]-[#7](-[#6]-[#6]-2)-[#6](=O)-n2cncn2)c1
BDBM50065645 O=[#6](-[#7]-1-[#6]-[#6]\[#6](-[#6]-[#6]-1)=[#6]-1/c2ccccc2-[#6]=[#6]-c2ccccc-12)-n1cncn1 |c:17|
BDBM50118167 CN(C1CCCCCCC1)C(=O)Oc1nsnc1N1CCOCC1
BDBM50118172 COc1nn(Cc2cccc(c2)C(F)(F)F)c(=O)o1
BDBM50118164 COC(=O)c1cccc(Cn2nc(OC)oc2=O)c1
BDBM50118168 Nc1cccc(Cn2nc(Oc3ccccc3)oc2=O)c1
BDBM50118169 [O-][N+](=O)c1cccc(Cn2nc(Oc3ccccc3)oc2=O)c1
BDBM50118173 COc1nn(Cc2cccc(N)c2)c(=O)o1
BDBM50211233 COc1cccc(CC2CCCCN2C(=O)n2ncc(n2)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)c1
BDBM50211234 O[C@@H]1CN([C@@H](Cc2ccccc2)C=C1)C(=O)n1ncc(n1)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |r,c:13|
BDBM50211235 OC(c1cn(nn1)C(=O)N1CCCCC1Cc1ccccc1)(c1ccccc1)c1ccccc1
BDBM50211236 O=C(N1CCCCC1Cc1ccccc1)n1cc(nn1)-c1ccc(cc1)-c1ccccc1
BDBM50211237 OC(C1CCCCC1)(C1CCCCC1)c1cnn(n1)C(=O)N1CCCCC1Cc1ccccc1
BDBM50211240 OC(c1cnn(n1)C(=O)N1C[C@@H](CC[C@@H]1Cc1ccccc1)OCC1CC1)(c1ccc(F)cc1)c1ccc(F)cc1 |r|
BDBM50211255 COC(c1cnn(n1)C(=O)N1CCCCC1Cc1ccccc1)(c1ccc(F)cc1)c1ccc(F)cc1
BDBM50211256 OC(c1cnn(n1)C(=O)N1CCCCC1COc1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1
BDBM50211257 OC(c1cnn(n1)C(=O)N1C[C@@H](CC[C@@H]1Cc1ccccc1)OCC#C)(c1ccc(F)cc1)c1ccc(F)cc1 |r|
BDBM50211258 OC(c1cnn(n1)C(=O)N1CCCCC1Cc1ccccc1)(c1ccccn1)c1ccccn1
BDBM50211259 O=C(N1CCCC[C@H]1Cc1ccccc1)n1cc(nn1)-c1ccc(cc1)-c1ccccc1 |r|
BDBM50211260 OC(c1cnn(n1)C(=O)N1CCCCC1Cc1ccccc1)(c1ccccc1)c1ccccc1
BDBM50211261 OC(c1cnn(n1)C(=O)N1CCCCC1COc1ccccc1)(c1ccccc1)c1ccccc1
BDBM50211262 CO[C@H]1CC[C@H](Cc2ccccc2)N(C1)C(=O)n1ncc(n1)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |r|
BDBM50211263 OC1(CCCCC1)c1cnn(n1)C(=O)N1CCCCC1Cc1ccccc1
BDBM50211266 O=C(N1CCCC[C@@H]1Cc1ccccc1)n1cc(nn1)-c1ccc(cc1)-c1ccccc1 |r|
BDBM50211267 OC(c1cnn(n1)C(=O)N1C[C@H](CC[C@@H]1Cc1ccccc1)OCC1CC1)(c1ccc(F)cc1)c1ccc(F)cc1 |r|
BDBM50211268 O[C@@H]1CC[C@H](Cc2ccccc2)N(C1)C(=O)n1ncc(n1)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |r|
BDBM50211269 OC(c1cnn(n1)C(=O)N1CCCCC1Cc1ccccc1)(c1ccc(F)cc1)c1ccc(F)cc1
BDBM50211270 CC(O)(c1cnn(n1)C(=O)N1CCCCC1Cc1ccccc1)c1ccccc1
BDBM50211271 CO[C@@H]1CC[C@H](Cc2ccccc2)N(C1)C(=O)n1ncc(n1)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |r|
BDBM50211272 O[C@H]1CC[C@H](Cc2ccccc2)N(C1)C(=O)n1ncc(n1)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |r|
BDBM50211273 OC(c1cnn(n1)C(=O)N1CCCCC1COc1ccc(F)cc1)(c1ccccc1)c1ccccc1
BDBM50211274 OC(c1cnn(n1)C(=O)N1CCCCC1COc1ccccc1)(c1ccc(F)cc1)c1ccc(F)cc1
BDBM50211275 O[C@H]1CN([C@@H](Cc2ccccc2)C=C1)C(=O)n1ncc(n1)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |r,c:13|
BDBM50211277 COc1ccc(CC2CCCCN2C(=O)n2ncc(n2)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)cc1
BDBM50211278 CC(C)(O)c1cnn(n1)C(=O)N1CCCCC1Cc1ccccc1