BindingDB logo
myBDB logout

56 SMILES Strings for Monoamine oxidase B

Compound NameSMILES String
BDBM15581 CN(CCCOc1ccc(Cl)cc1Cl)CC#C
BDBM22787 CC(=O)N1C(=O)C(=O)c2ccccc12
BDBM50088559 COC(=O)CCCNC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1
BDBM50088557 COC(=O)C1(CCCC1)NC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1
BDBM50088561 COC(=O)C[C@H](NC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1)C(=O)OC |r|
BDBM50088563 COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1 |r|
BDBM50097458 NNC(=O)CN1C(Nc2ccccc2C1=O)c1ccc(Cl)cc1
BDBM50097459 COC(=O)C(C)N1C(Nc2ccccc2C1=O)c1ccc2OCOc2c1
BDBM50097460 COC(=O)C(C)N1C(Nc2ccccc2C1=O)c1ccco1
BDBM50097461 COC(=O)C(Cc1ccccc1)N1C(Nc2ccccc2C1=O)c1ccco1
BDBM50097462 COC(=O)C(Cc1ccccc1)N1C(Nc2ccccc2C1=O)c1ccc(Cl)cc1
BDBM50097463 COC(=O)CN1C(Nc2ccccc2C1=O)c1ccc(Cl)cc1
BDBM50097464 COC(=O)CN1C(Nc2ccccc2C1=O)c1ccc(OC)cc1
BDBM50097465 COC(=O)C(C)N1C(Nc2ccccc2C1=O)c1ccccc1
BDBM50097466 COC(=O)CCCCCNC(=O)c1ccccc1N
BDBM50097467 COC(=O)CN1C(Nc2ccccc2C1=O)c1ccccc1
BDBM50097468 COC(=O)CN1C(Nc2ccccc2C1=O)c1ccc2OCOc2c1
BDBM50097469 COC(=O)CN1C(Nc2ccccc2C1=O)c1ccco1
BDBM50097470 COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1N |r|
BDBM50097471 COC(=O)CCNC(=O)c1ccccc1N
BDBM50097472 COC(=O)CCCNC(=O)c1ccccc1N
BDBM50093608 COC(=O)CCCCCN1C(Nc2ccccc2C1=O)c1ccc2OCOc2c1
BDBM50093642 COC(=O)[C@H](C)NC(=O)c1ccccc1N |r|
BDBM50093703 NNC(=O)CCCN1C(Nc2ccccc2C1=O)c1ccc2OCOc2c1
BDBM50093709 NNC(=O)CCN1C(Nc2ccccc2C1=O)c1ccc(Cl)cc1
BDBM50093711 NNC(=O)CCN1C(Nc2ccccc2C1=O)c1ccccc1
BDBM50093713 COC(=O)CCCN1C(Nc2ccccc2C1=O)c1ccco1
BDBM50093714 COC(=O)CCCN1C(Nc2ccccc2C1=O)c1ccc2OCOc2c1
BDBM50093715 COC(=O)CCCN1C(Nc2ccccc2C1=O)c1ccccc1
BDBM50093756 COC(=O)CCN1C(Nc2ccccc2C1=O)c1ccc(Cl)cc1
BDBM50093757 COC(=O)CCN1C(Nc2ccccc2C1=O)c1ccc2OCOc2c1
BDBM50093778 NNC(=O)C(Cc1ccccc1)N1C(Nc2ccccc2C1=O)c1ccc(Cl)cc1
BDBM50093779 NNC(=O)C(Cc1ccccc1)N1C(Nc2ccccc2C1=O)c1ccco1
BDBM50097420 CC(N1C(Nc2ccccc2C1=O)c1ccco1)C(=O)NN
BDBM50097438 NNC(=O)CN1C(Nc2ccccc2C1=O)c1ccccc1
BDBM50097419 COc1ccc(cc1)C1Nc2ccccc2C(=O)N1CC(=O)NN
BDBM50097456 NNC(=O)CN1C(Nc2ccccc2C1=O)c1ccc2OCOc2c1
BDBM50097457 NNC(=O)CN1C(Nc2ccccc2C1=O)c1ccco1
BDBM50093609 COC(=O)CCCCCN1C(Nc2ccccc2C1=O)c1ccc(Cl)cc1
BDBM50093668 COC(=O)CNC(=O)c1ccccc1N
BDBM50093694 NNC(=O)CCCN1C(Nc2ccccc2C1=O)c1ccco1
BDBM50093707 NNC(=O)CCCN1C(Nc2ccccc2C1=O)c1ccccc1
BDBM50093710 NNC(=O)CCN1C(Nc2ccccc2C1=O)c1ccc2OCOc2c1
BDBM50093712 COC(=O)CCCCCNC(=O)c1ccccc1\N=C\c1ccccc1
BDBM50093758 COC(=O)CCN1C(Nc2ccccc2C1=O)c1ccccc1
BDBM50088554 COC(=O)C[C@H](NC(=O)C(=O)c1ccccc1NC(C)=O)C(=O)OC |r|
BDBM50088555 COC(=O)[C@H](CC(C)C)NC(=O)C(=O)c1ccccc1NC(C)=O |r|
BDBM50088556 CCOC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1
BDBM50088558 COC(=O)CCCCCNC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1
BDBM50088560 COC(=O)CCNC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1
BDBM50088562 COC(=O)C(C)(C)NC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1
BDBM50088564 COC(=O)[C@@H](NC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1)C(C)C |r|
BDBM50088565 COC(=O)[C@H](C)NC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1 |r|
BDBM50088566 COC(=O)CCCCCNC(=O)C(=O)c1ccccc1NC(C)=O
BDBM50088567 COC(=O)CCCNC(=O)C(=O)c1ccccc1NC(C)=O
BDBM50088568 COC(=O)CCNC(=O)C(=O)c1ccccc1NC(C)=O