BindingDB logo
myBDB logout

11 SMILES Strings for Monoamine oxidase B (MAO-B)

Compound NameSMILES String
BDBM24774 ClC1=C(Cl)C(=O)c2ccccc2C1=O |c:1|
BDBM24775 COC1=CC(=O)c2ccccc2C1=O |t:2|
BDBM24776 O=C1C=CC(=O)c2ccccc12 |c:2|
BDBM24777 Oc1cccc2C(=O)C=CC(=O)c12 |c:8|
BDBM24778 CC1=CC(=O)c2ccccc2C1=O |t:1|
BDBM50012070 CC1=CC(=O)c2c(O)cccc2C1=O |t:1|
BDBM50060898 Oc1ccc(O)c2C(=O)C=CC(=O)c12 |c:9|
BDBM178087 CC1=C(CCl)C(=O)c2ccccc2C1=O |c:1|
BDBM178088 OC1=C(Cl)C(=O)c2ccccc2C1=O |c:1|
BDBM178089 OCCCCOC1=C(Cl)C(=O)c2ccccc2C1=O |c:6|
BDBM178090 [#6]\[#6](-[#6])=[#6]\[#6]-[#6](-[#8])-[#6]-1=[#6]-[#6](=O)-c2c(-[#8])ccc(-[#8])c2-[#6]-1=O |t:7|