BindingDB logo
myBDB logout

5 SMILES Strings for Monoamine oxidase type B (MAO-B) Mutant (I199F)

Compound NameSMILES String
BDBM10989 C#CCN[C@@H]1CCc2ccccc12 |r|
BDBM11018 CC1c2nc(\C=C\c3cccc(Cl)c3)n(C)c2C(=O)N(C)C1=O
BDBM11020 C(\C=C\Cc1ccccc1)c1ccccc1
BDBM11021 [#6]\[#6](-[#6])=[#6]\[#6]-[#6]\[#6](-[#6])=[#6]\[#6]-[#6]\[#6](-[#6])=[#6]\[#6]-[#8]
BDBM11022 O=C1Nc2ccccc2C1=O