BindingDB logo
myBDB logout

2 SMILES Strings for Monocarboxylate transporter 10

Compound NameSMILES String
BDBM92690 [O-]C(=O)C(Cc1c[nH]c2ccccc12)[NH+]=C
BDBM50043821 CC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O