BindingDB logo
myBDB logout

9 SMILES Strings for Monocarboxylate transporter 2

Compound NameSMILES String
BDBM4350 OC(=O)C(=C\c1ccc(O)cc1)\C#N
BDBM7460 Oc1cc(O)c2c(c1)oc(-c1ccc(O)c(O)c1)c(O)c2=O
BDBM19473 CC(=O)C(O)=O
BDBM23446 Oc1ccc(CCC(=O)c2c(O)cc(O)cc2O)cc1
BDBM50158460 CCc1oc2ccccc2c1C(=O)c1cc(Br)c(O)c(Br)c1
BDBM50270275 CC(O)CC([O-])=O
BDBM50390988 CC(C)CC(=O)C(O)=O
BDBM50390989 CC(C)C(=O)C(O)=O
BDBM50390990 CC(=O)CC([O-])=O